Products 1097012-01-5
CAS 1097012-01-5 is the registry number for 4-(1,3-Dioxaindan-5-yl)-3-cyclobutyl-1,2-oxazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(1,3-benzodioxol-5-yl)-3-cyclobutyl-1,2-oxazol-5-amine (CAS 1097012-01-5) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-3-cyclobutyl-1,2-oxazol-5-amine. InChIKey: YLNJIERZVNKXFZ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)-3-cyclobutyl-1,2-oxazol-5-amine |
| InChIKey | YLNJIERZVNKXFZ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NOC(=C2C3=CC4=C(C=C3)OCO4)N |
Computed by PubChem (NCBI)