CAS 1097095-35-6 is the registry number for 1-(3-Chlorophenyl)-6-methyl-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-chlorophenyl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1097095-35-6) is a chemical compound with the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. IUPAC name: 1-(3-chlorophenyl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: FGNFLLALMJCHAE-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4O |
|---|---|
| Molecular weight | 260.68 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-6-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | FGNFLLALMJCHAE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C3=CC(=CC=C3)Cl)C(=O)N1 |
Computed by PubChem (NCBI)