CAS 402570-41-6 is the registry number for 5-(4-Chlorobenzyl)-1,5-dihydro-4h-pyrazolo[3,4-d]pyrimidin-4-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-[(4-chlorophenyl)methyl]-1H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 402570-41-6) is a chemical compound with the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. IUPAC name: 5-[(4-chlorophenyl)methyl]-1H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: WYYUYPJVUXFPPM-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4O |
|---|---|
| Molecular weight | 260.68 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methyl]-1H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | WYYUYPJVUXFPPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC3=C(C2=O)C=NN3)Cl |
Computed by PubChem (NCBI)