CAS 1803589-53-8 appears in our catalog under these names: 6-Chloro-1-methyl-5-phenyl-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one, 95%, 6-Chloro-1-methyl-5-phenyl-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-chloro-1-methyl-5-phenylpyrazolo[5,4-d]pyrimidin-4-one (CAS 1803589-53-8) is a chemical compound with the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. IUPAC name: 6-chloro-1-methyl-5-phenylpyrazolo[5,4-d]pyrimidin-4-one. InChIKey: NVCRLNIXHSXEDW-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4O |
|---|---|
| Molecular weight | 260.68 g/mol |
| IUPAC name | 6-chloro-1-methyl-5-phenylpyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | NVCRLNIXHSXEDW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)N(C(=N2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)