CAS 7190-82-1 is the registry number for 6-Chloro-3-(4-methoxyphenyl)[1,2,4]triazolo[4,3-b]pyridazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 7190-82-1) is a chemical compound with the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. IUPAC name: 6-chloro-3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: WRZRWPPFCQRGMX-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4O |
|---|---|
| Molecular weight | 260.68 g/mol |
| IUPAC name | 6-chloro-3-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | WRZRWPPFCQRGMX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)