Products 1097095-73-2
CAS 1097095-73-2 is the registry number for 7-tert-Butyl-5-methoxy-3-methyl-1-benzofuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7-tert-butyl-5-methoxy-3-methyl-1-benzofuran-2-carboxylic acid (CAS 1097095-73-2) is a chemical compound with the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. IUPAC name: 7-tert-butyl-5-methoxy-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: NAQGWLRVNCPOKP-UHFFFAOYSA-N.
| Molecular formula | C15H18O4 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 7-tert-butyl-5-methoxy-3-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | NAQGWLRVNCPOKP-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2C(C)(C)C)OC)C(=O)O |
Computed by PubChem (NCBI)