Products 1097129-82-2
CAS 1097129-82-2 is the registry number for 3-((2-Oxopyrimidin-1(2H)-yl)methyl)benzo[b]thiophene-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2-oxopyrimidin-1-yl)methyl]-1-benzothiophene-2-carboxylic acid (CAS 1097129-82-2) is a chemical compound with the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. IUPAC name: 3-[(2-oxopyrimidin-1-yl)methyl]-1-benzothiophene-2-carboxylic acid. InChIKey: GBBVIZVBDLSPRM-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3S |
|---|---|
| Molecular weight | 286.31 g/mol |
| IUPAC name | 3-[(2-oxopyrimidin-1-yl)methyl]-1-benzothiophene-2-carboxylic acid |
| InChIKey | GBBVIZVBDLSPRM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C(=O)O)CN3C=CC=NC3=O |
Computed by PubChem (NCBI)