CAS 919466-69-6 appears in our catalog under these names: 2-([5-(Naphthalen-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl)acetic acid, 95%, 2-{(5-(naphthalen-2-yl)-1,3,4-oxadiazol-2-yl)sulfanyl}acetic acid, 95%, 2-{(5-(Naphthalen-2-yl)-1,3,4-oxadiazol-2-yl)sulfanyl}acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid (CAS 919466-69-6) is a chemical compound with the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. IUPAC name: 2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid. InChIKey: BZUCBECNLJAGCX-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3S |
|---|---|
| Molecular weight | 286.31 g/mol |
| IUPAC name | 2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid |
| InChIKey | BZUCBECNLJAGCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NN=C(O3)SCC(=O)O |
Computed by PubChem (NCBI)