Products 874834-22-7

CAS 874834-22-7 is the registry number for 4-(Benzo(c)(1,2,5)thiadiazol-5-ylmethoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(2,1,3-benzothiadiazol-5-ylmethoxy)benzoic acid (CAS 874834-22-7) is a chemical compound with the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. IUPAC name: 4-(2,1,3-benzothiadiazol-5-ylmethoxy)benzoic acid. InChIKey: XMIGBCQVLDLCFO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10N2O3S
Molecular weight286.31 g/mol
IUPAC name4-(2,1,3-benzothiadiazol-5-ylmethoxy)benzoic acid
InChIKeyXMIGBCQVLDLCFO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OCC2=CC3=NSN=C3C=C2

Computed by PubChem (NCBI)