CAS 954260-10-7 appears in our catalog under these names: 2-Benzyl-5-oxo-5H-(1,3)thiazolo(3,2-a)pyrimidine-6-carboxylic acid, 95%, 2-Benzyl-5-oxo-5H-(1,3)thiazolo(3,2-a)pyrimidine-6-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-benzyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid (CAS 954260-10-7) is a chemical compound with the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. IUPAC name: 2-benzyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid. InChIKey: PMKPYSURELAEQU-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3S |
|---|---|
| Molecular weight | 286.31 g/mol |
| IUPAC name | 2-benzyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid |
| InChIKey | PMKPYSURELAEQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CN3C(=O)C(=CN=C3S2)C(=O)O |
Computed by PubChem (NCBI)