Products 109774-57-4
CAS 109774-57-4 appears in our catalog under these names: Di-tert-butyl benzylimidodicarbonate, 95%, Di-tert-butyl benzylimidodiarbonate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl N-benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 109774-57-4) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: tert-butyl N-benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: UBBCBDIQXSNCEQ-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | tert-butyl N-benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | UBBCBDIQXSNCEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC1=CC=CC=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)