CAS 1623005-34-4 is the registry number for N,N-Diboc-4-methylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
Tert-butyl N-(4-methylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1623005-34-4) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: tert-butyl N-(4-methylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: HXRZMERTWHZONI-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | tert-butyl N-(4-methylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | HXRZMERTWHZONI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)