CAS 1398047-46-5 is the registry number for 4-(4-tert-Butoxycarbonylamino-phenyl)-2,2-dimethyl-butyric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2-dimethyl-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid (CAS 1398047-46-5) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: 2,2-dimethyl-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid. InChIKey: UTZUBOLNQJAFQJ-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 2,2-dimethyl-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid |
| InChIKey | UTZUBOLNQJAFQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)CCC(C)(C)C(=O)O |
Computed by PubChem (NCBI)