CAS 453557-73-8 appears in our catalog under these names: 3-N-Boc-3-(4-isopropylphenyl)propionic acid, 95%, 3-((tert-Butoxycarbonyl)amino)-3-(4-isopropylphenyl)propanoic acid, 3-((tert-Butoxycarbonyl)amino)-3-(4-isopropylphenyl)propanoic acid 95+%, 3-N-BOC-3-(4-ISOPROPYLPHENYL)PROPIONIC ACID, 95+%, 95+%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 0,5g, 100mg.
3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-propan-2-ylphenyl)propanoic acid (CAS 453557-73-8) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-propan-2-ylphenyl)propanoic acid. InChIKey: ZLUXRQGEUCGUFS-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-propan-2-ylphenyl)propanoic acid |
| InChIKey | ZLUXRQGEUCGUFS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)