CAS 1097780-66-9 is the registry number for (2E)-3-(2-(2,3,6-Trimethylphenoxy)phenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(E)-3-[2-(2,3,6-trimethylphenoxy)phenyl]prop-2-enoic acid (CAS 1097780-66-9) is a chemical compound with the molecular formula C18H18O3 and a molecular weight of 282.3 g/mol. IUPAC name: (E)-3-[2-(2,3,6-trimethylphenoxy)phenyl]prop-2-enoic acid. InChIKey: WXPOLSQBRBTEDI-ZHACJKMWSA-N.
| Molecular formula | C18H18O3 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | (E)-3-[2-(2,3,6-trimethylphenoxy)phenyl]prop-2-enoic acid |
| InChIKey | WXPOLSQBRBTEDI-ZHACJKMWSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)OC2=CC=CC=C2/C=C/C(=O)O)C |
Computed by PubChem (NCBI)