Products 109831-24-5
CAS 109831-24-5 is the registry number for Vilazodone Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 5-nitro-3H-1-benzofuran-2,2-dicarboxylate (CAS 109831-24-5) is a chemical compound with the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. IUPAC name: diethyl 5-nitro-3H-1-benzofuran-2,2-dicarboxylate. InChIKey: NMIMXJUIYPPFGE-UHFFFAOYSA-N.
| Molecular formula | C14H15NO7 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | diethyl 5-nitro-3H-1-benzofuran-2,2-dicarboxylate |
| InChIKey | NMIMXJUIYPPFGE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC2=C(O1)C=CC(=C2)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)