Products 861384-91-0
CAS 861384-91-0 is the registry number for Ethyl 4-(ethoxycarbonyl)-2-nitro-α-oxobenzenepropanoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
Ethyl 4-(3-ethoxy-2,3-dioxopropyl)-3-nitrobenzoate (CAS 861384-91-0) is a chemical compound with the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. IUPAC name: ethyl 4-(3-ethoxy-2,3-dioxopropyl)-3-nitrobenzoate. InChIKey: CCXXAFXITIWISV-UHFFFAOYSA-N.
| Molecular formula | C14H15NO7 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | ethyl 4-(3-ethoxy-2,3-dioxopropyl)-3-nitrobenzoate |
| InChIKey | CCXXAFXITIWISV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)CC(=O)C(=O)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)