CAS 177715-70-7 is the registry number for N-((2E)-3-(4-Hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl)-L-aspartic Acid (~98%). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(2S)-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]butanedioic acid (CAS 177715-70-7) is a chemical compound with the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. IUPAC name: (2S)-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]butanedioic acid. InChIKey: SLAOOTKASUKZIE-SGRBOOSSSA-N.
| Molecular formula | C14H15NO7 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | (2S)-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]butanedioic acid |
| InChIKey | SLAOOTKASUKZIE-SGRBOOSSSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)N[C@@H](CC(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)