CAS 860295-23-4 appears in our catalog under these names: (S,E)-2-(3-(3,4-Dihydroxyphenyl)acrylamido)pentanedioic acid, 97%, N-(3’,4’-Dihydroxy-(E)-cinnamoyl)-L-glutamic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]pentanedioic acid (CAS 860295-23-4) is a chemical compound with the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. IUPAC name: (2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]pentanedioic acid. InChIKey: PRCRWIWEDONYKC-MAHOQKISSA-N.
| Molecular formula | C14H15NO7 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | (2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]pentanedioic acid |
| InChIKey | PRCRWIWEDONYKC-MAHOQKISSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)N[C@@H](CCC(=O)O)C(=O)O)O)O |
Computed by PubChem (NCBI)