CAS 1098340-12-5 is the registry number for 1-(2,4-Difluorobenzyl)-5-oxopyrrolidine-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[(2,4-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 1098340-12-5) is a chemical compound with the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. IUPAC name: 1-[(2,4-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: HIELWKUFWOBERF-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO3 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 1-[(2,4-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | HIELWKUFWOBERF-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)