Products 1098340-14-7

CAS 1098340-14-7 is the registry number for 1-(3,5-Difluorobenzyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-[(3,5-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 1098340-14-7) is a chemical compound with the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. IUPAC name: 1-[(3,5-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: AQJCRGUHSRBSGR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11F2NO3
Molecular weight255.22 g/mol
IUPAC name1-[(3,5-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid
InChIKeyAQJCRGUHSRBSGR-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)CC2=CC(=CC(=C2)F)F)C(=O)O

Computed by PubChem (NCBI)