CAS 2501983-98-6 is the registry number for Methyl 4,6-difluoro-7-methoxy-2-methyl-1H-indole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,6-difluoro-7-methoxy-2-methyl-1H-indole-3-carboxylate (CAS 2501983-98-6) is a chemical compound with the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. IUPAC name: methyl 4,6-difluoro-7-methoxy-2-methyl-1H-indole-3-carboxylate. InChIKey: QSIVSPHJMLSKAW-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO3 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | methyl 4,6-difluoro-7-methoxy-2-methyl-1H-indole-3-carboxylate |
| InChIKey | QSIVSPHJMLSKAW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C(=C(C=C2F)F)OC)C(=O)OC |
Computed by PubChem (NCBI)