CAS 304859-20-9 appears in our catalog under these names: 1-(2,6-Difluorobenzyl)-5-oxo-3-pyrrolidinecarboxylic acid, 95%, 1-(2,6-difluorobenzyl)-5-oxopyrrolidine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 2,5g.
1-[(2,6-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 304859-20-9) is a chemical compound with the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. IUPAC name: 1-[(2,6-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: LMXMCRSCDJNUNL-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO3 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 1-[(2,6-difluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | LMXMCRSCDJNUNL-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=C(C=CC=C2F)F)C(=O)O |
Computed by PubChem (NCBI)