Products 1098384-79-2
CAS 1098384-79-2 is the registry number for 2-((5,6-Dichloropyridin-3-yl)formamido)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[(5,6-dichloropyridine-3-carbonyl)amino]acetic acid (CAS 1098384-79-2) is a chemical compound with the molecular formula C8H6Cl2N2O3 and a molecular weight of 249.05 g/mol. IUPAC name: 2-[(5,6-dichloropyridine-3-carbonyl)amino]acetic acid. InChIKey: FYNHUINXQWOQRU-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O3 |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 2-[(5,6-dichloropyridine-3-carbonyl)amino]acetic acid |
| InChIKey | FYNHUINXQWOQRU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)