CAS 1539296-54-2 is the registry number for Ethyl 2-(3,5-dichloropyrazin-2-yl)-2-oxoacetate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 2-(3,5-dichloropyrazin-2-yl)-2-oxoacetate (CAS 1539296-54-2) is a chemical compound with the molecular formula C8H6Cl2N2O3 and a molecular weight of 249.05 g/mol. IUPAC name: ethyl 2-(3,5-dichloropyrazin-2-yl)-2-oxoacetate. InChIKey: VDHKTKHIZPMIJI-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O3 |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | ethyl 2-(3,5-dichloropyrazin-2-yl)-2-oxoacetate |
| InChIKey | VDHKTKHIZPMIJI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=NC=C(N=C1Cl)Cl |
Computed by PubChem (NCBI)