CAS 34004-41-6 is the registry number for 2-Chloro-N-(2-chloro-4-nitrophenyl)acetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-N-(2-chloro-4-nitrophenyl)acetamide (CAS 34004-41-6) is a chemical compound with the molecular formula C8H6Cl2N2O3 and a molecular weight of 249.05 g/mol. IUPAC name: 2-chloro-N-(2-chloro-4-nitrophenyl)acetamide. InChIKey: LGKLKAQMOASLBD-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O3 |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro-4-nitrophenyl)acetamide |
| InChIKey | LGKLKAQMOASLBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)CCl |
Computed by PubChem (NCBI)