CAS 50610-31-6 is the registry number for N-(2,4-dichloro-5-nitrophenyl)acetamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(2,4-dichloro-5-nitrophenyl)acetamide (CAS 50610-31-6) is a chemical compound with the molecular formula C8H6Cl2N2O3 and a molecular weight of 249.05 g/mol. IUPAC name: N-(2,4-dichloro-5-nitrophenyl)acetamide. InChIKey: TXIZZIMANJFWCR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O3 |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | N-(2,4-dichloro-5-nitrophenyl)acetamide |
| InChIKey | TXIZZIMANJFWCR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)