CAS 109901-94-2 is the registry number for Sepiapterin Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-7-methyl-6,7-dihydro-3H-pteridin-4-one (CAS 109901-94-2) is a chemical compound with the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. IUPAC name: 2-amino-7-methyl-6,7-dihydro-3H-pteridin-4-one. InChIKey: KYMQRHJOMLYXNX-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 2-amino-7-methyl-6,7-dihydro-3H-pteridin-4-one |
| InChIKey | KYMQRHJOMLYXNX-UHFFFAOYSA-N |
| SMILES | CC1CN=C2C(=O)NC(=NC2=N1)N |
Computed by PubChem (NCBI)