Products 109901-94-2

CAS 109901-94-2 is the registry number for Sepiapterin Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-amino-7-methyl-6,7-dihydro-3H-pteridin-4-one (CAS 109901-94-2) is a chemical compound with the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. IUPAC name: 2-amino-7-methyl-6,7-dihydro-3H-pteridin-4-one. InChIKey: KYMQRHJOMLYXNX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9N5O
Molecular weight179.18 g/mol
IUPAC name2-amino-7-methyl-6,7-dihydro-3H-pteridin-4-one
InChIKeyKYMQRHJOMLYXNX-UHFFFAOYSA-N
SMILESCC1CN=C2C(=O)NC(=NC2=N1)N

Computed by PubChem (NCBI)