CAS 879034-73-8 is the registry number for 2-Amino-5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-amino-5,6-dimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 879034-73-8) is a chemical compound with the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. IUPAC name: 2-amino-5,6-dimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: VFXLDXXGTGVXAX-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 2-amino-5,6-dimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | VFXLDXXGTGVXAX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2N=C(NN2C1=O)N)C |
Computed by PubChem (NCBI)