CAS 183558-84-1 is the registry number for 6-Ethyl Guanine-d5. Offered by: TRC. Available pack sizes: 25mg, 5mg.
6-(1,1,2,2,2-pentadeuterioethoxy)-7H-purin-2-amine (CAS 183558-84-1) is a chemical compound with the molecular formula C7H9N5O and a molecular weight of 184.21 g/mol. IUPAC name: 6-(1,1,2,2,2-pentadeuterioethoxy)-7H-purin-2-amine. InChIKey: SFXXRVSPZSOREJ-ZBJDZAJPSA-N.
| Molecular formula | C7H9N5O |
|---|---|
| Molecular weight | 184.21 g/mol |
| IUPAC name | 6-(1,1,2,2,2-pentadeuterioethoxy)-7H-purin-2-amine |
| InChIKey | SFXXRVSPZSOREJ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=NC(=NC2=C1NC=N2)N |
Computed by PubChem (NCBI)