CAS 126595-74-2 is the registry number for N7-(2-Hydroxyethyl)adenine. Offered by: TRC. Available pack sizes: 100mg.
2-(6-aminopurin-7-yl)ethanol (CAS 126595-74-2) is a chemical compound with the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. IUPAC name: 2-(6-aminopurin-7-yl)ethanol. InChIKey: XOMKQMGJBJAMCE-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 2-(6-aminopurin-7-yl)ethanol |
| InChIKey | XOMKQMGJBJAMCE-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N=CN2CCO)N |
Computed by PubChem (NCBI)