CAS 1099597-35-9 is the registry number for 4-Chloro-2,5-difluorobenzotrifluoride, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g.
1-chloro-2,5-difluoro-4-(trifluoromethyl)benzene (CAS 1099597-35-9) is a chemical compound with the molecular formula C7H2ClF5 and a molecular weight of 216.53 g/mol. IUPAC name: 1-chloro-2,5-difluoro-4-(trifluoromethyl)benzene. InChIKey: OSHAWXYKNXIRNX-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF5 |
|---|---|
| Molecular weight | 216.53 g/mol |
| IUPAC name | 1-chloro-2,5-difluoro-4-(trifluoromethyl)benzene |
| InChIKey | OSHAWXYKNXIRNX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)