CAS 1261846-28-9 is the registry number for 4-Chloro-3,5-difluorobenzotrifluoride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-1,3-difluoro-5-(trifluoromethyl)benzene (CAS 1261846-28-9) is a chemical compound with the molecular formula C7H2ClF5 and a molecular weight of 216.53 g/mol. IUPAC name: 2-chloro-1,3-difluoro-5-(trifluoromethyl)benzene. InChIKey: DBXGGVURUQFFGT-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF5 |
|---|---|
| Molecular weight | 216.53 g/mol |
| IUPAC name | 2-chloro-1,3-difluoro-5-(trifluoromethyl)benzene |
| InChIKey | DBXGGVURUQFFGT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)