CAS 1208076-15-6 is the registry number for 6-Chloro-2,3-difluorobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-chloro-3,4-difluoro-2-(trifluoromethyl)benzene (CAS 1208076-15-6) is a chemical compound with the molecular formula C7H2ClF5 and a molecular weight of 216.53 g/mol. IUPAC name: 1-chloro-3,4-difluoro-2-(trifluoromethyl)benzene. InChIKey: IETMTNZSWMUANU-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF5 |
|---|---|
| Molecular weight | 216.53 g/mol |
| IUPAC name | 1-chloro-3,4-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | IETMTNZSWMUANU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C(F)(F)F)Cl |
Computed by PubChem (NCBI)