CAS 653-35-0 appears in our catalog under these names: 2,3,4,5,6–Pentafluorobenzyl chloride, 1-(Chloromethyl)-2,3,4,5,6-pentafluorobenzene 98%, Pentafluorobenzyl chloride, 98%+,RG. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g.
1-(chloromethyl)-2,3,4,5,6-pentafluorobenzene (CAS 653-35-0) is a chemical compound with the molecular formula C7H2ClF5 and a molecular weight of 216.53 g/mol. IUPAC name: 1-(chloromethyl)-2,3,4,5,6-pentafluorobenzene. InChIKey: ZLNVRXFZTPRLIK-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF5 |
|---|---|
| Molecular weight | 216.53 g/mol |
| IUPAC name | 1-(chloromethyl)-2,3,4,5,6-pentafluorobenzene |
| InChIKey | ZLNVRXFZTPRLIK-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)Cl |
Computed by PubChem (NCBI)