CAS 1099598-25-0 is the registry number for 1,3-Dichloro-2-(2,2,2-trifluoroethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1,3-dichloro-2-(2,2,2-trifluoroethyl)benzene (CAS 1099598-25-0) is a chemical compound with the molecular formula C8H5Cl2F3 and a molecular weight of 229.02 g/mol. IUPAC name: 1,3-dichloro-2-(2,2,2-trifluoroethyl)benzene. InChIKey: IWVCYQDSZUAMEP-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3 |
|---|---|
| Molecular weight | 229.02 g/mol |
| IUPAC name | 1,3-dichloro-2-(2,2,2-trifluoroethyl)benzene |
| InChIKey | IWVCYQDSZUAMEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(F)(F)F)Cl |
Computed by PubChem (NCBI)