CAS 24096-63-7 is the registry number for 2-Chloro-1-(chloromethyl)-4-(trifluoromethyl)benzene, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-chloro-1-(chloromethyl)-4-(trifluoromethyl)benzene (CAS 24096-63-7) is a chemical compound with the molecular formula C8H5Cl2F3 and a molecular weight of 229.02 g/mol. IUPAC name: 2-chloro-1-(chloromethyl)-4-(trifluoromethyl)benzene. InChIKey: SMFUEEBHKGCPIN-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3 |
|---|---|
| Molecular weight | 229.02 g/mol |
| IUPAC name | 2-chloro-1-(chloromethyl)-4-(trifluoromethyl)benzene |
| InChIKey | SMFUEEBHKGCPIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)CCl |
Computed by PubChem (NCBI)