Products 74483-51-5
CAS 74483-51-5 appears in our catalog under these names: 3,4-Dichloro-6-(trifluoromethyl)toluene, 95%, 1,2-Dichloro-4-methyl-5-(trifluoromethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
1,2-dichloro-4-methyl-5-(trifluoromethyl)benzene (CAS 74483-51-5) is a chemical compound with the molecular formula C8H5Cl2F3 and a molecular weight of 229.02 g/mol. IUPAC name: 1,2-dichloro-4-methyl-5-(trifluoromethyl)benzene. InChIKey: OARYHYOOIUIKFZ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3 |
|---|---|
| Molecular weight | 229.02 g/mol |
| IUPAC name | 1,2-dichloro-4-methyl-5-(trifluoromethyl)benzene |
| InChIKey | OARYHYOOIUIKFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)