CAS 1099597-16-6 appears in our catalog under these names: 1,2-Dichloro-4-(2,2,2-trifluoroethyl)benzene, 95-<97%, 1,2-Dichloro-4-(2,2,2-trifluoroethyl)benzene, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.
1,2-dichloro-4-(2,2,2-trifluoroethyl)benzene (CAS 1099597-16-6) is a chemical compound with the molecular formula C8H5Cl2F3 and a molecular weight of 229.02 g/mol. IUPAC name: 1,2-dichloro-4-(2,2,2-trifluoroethyl)benzene. InChIKey: TXZNHPZUQSPIGP-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3 |
|---|---|
| Molecular weight | 229.02 g/mol |
| IUPAC name | 1,2-dichloro-4-(2,2,2-trifluoroethyl)benzene |
| InChIKey | TXZNHPZUQSPIGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)