CAS 707-72-2 appears in our catalog under these names: 2-(Trifluoromethyl)benzalchloride, 2–(Trifluoromethyl)benzal Chloride, 2-(Trifluoromethyl)benzal Chloride, 2-(Trifluoromethyl)benzal chloride, 95%, 2-(Trifluoromethyl)benzal chloride, >=99%. Offered by: Chemat, GLPBio, TCI, Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 25g.
1-(dichloromethyl)-2-(trifluoromethyl)benzene (CAS 707-72-2) is a chemical compound with the molecular formula C8H5Cl2F3 and a molecular weight of 229.02 g/mol. IUPAC name: 1-(dichloromethyl)-2-(trifluoromethyl)benzene. InChIKey: JIJFXGFHPXLJME-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3 |
|---|---|
| Molecular weight | 229.02 g/mol |
| IUPAC name | 1-(dichloromethyl)-2-(trifluoromethyl)benzene |
| InChIKey | JIJFXGFHPXLJME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)