CAS 1099632-51-5 appears in our catalog under these names: Methyl 5-(chlorosulfonyl)-2,4-difluorobenzoate, Methyl 5-(chlorosulfonyl)-2,4-difluorobenzoate, 97%, Methyl 5-(chlorosulfonyl)-2,4-difluorobenzoate, 98%. Offered by: Biosynth, AmBeed, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
Methyl 5-chlorosulfonyl-2,4-difluorobenzoate (CAS 1099632-51-5) is a chemical compound with the molecular formula C8H5ClF2O4S and a molecular weight of 270.64 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2,4-difluorobenzoate. InChIKey: YISREXSAILYBAW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O4S |
|---|---|
| Molecular weight | 270.64 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-2,4-difluorobenzoate |
| InChIKey | YISREXSAILYBAW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)