Products 2414389-02-7
CAS 2414389-02-7 is the registry number for methyl 4-(chlorosulfonyl)-2,5-difluorobenzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 4-chlorosulfonyl-2,5-difluorobenzoate (CAS 2414389-02-7) is a chemical compound with the molecular formula C8H5ClF2O4S and a molecular weight of 270.64 g/mol. IUPAC name: methyl 4-chlorosulfonyl-2,5-difluorobenzoate. InChIKey: NKXBLCKSXGAKPM-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O4S |
|---|---|
| Molecular weight | 270.64 g/mol |
| IUPAC name | methyl 4-chlorosulfonyl-2,5-difluorobenzoate |
| InChIKey | NKXBLCKSXGAKPM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)