CAS 1247485-41-1 appears in our catalog under these names: Methyl 5-(chlorosulfonyl)-2,3-difluorobenzoate, 95%, Methyl 5-(chlorosulfonyl)-2,3-difluorobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 5-chlorosulfonyl-2,3-difluorobenzoate (CAS 1247485-41-1) is a chemical compound with the molecular formula C8H5ClF2O4S and a molecular weight of 270.64 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2,3-difluorobenzoate. InChIKey: HBMVYZJBPPMTEG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O4S |
|---|---|
| Molecular weight | 270.64 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-2,3-difluorobenzoate |
| InChIKey | HBMVYZJBPPMTEG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)S(=O)(=O)Cl)F)F |
Computed by PubChem (NCBI)