Products 2592405-50-8

CAS 2592405-50-8 is the registry number for 3-Chloro-5-((difluoromethyl)sulfonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-5-(difluoromethylsulfonyl)benzoic acid (CAS 2592405-50-8) is a chemical compound with the molecular formula C8H5ClF2O4S and a molecular weight of 270.64 g/mol. IUPAC name: 3-chloro-5-(difluoromethylsulfonyl)benzoic acid. InChIKey: ANGUIROOMQEHFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF2O4S
Molecular weight270.64 g/mol
IUPAC name3-chloro-5-(difluoromethylsulfonyl)benzoic acid
InChIKeyANGUIROOMQEHFJ-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1S(=O)(=O)C(F)F)Cl)C(=O)O

Computed by PubChem (NCBI)