CAS 1099660-64-6 is the registry number for 4-(1,3-Thiazol-2-yl)benzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(1,3-thiazol-2-yl)benzenesulfonyl chloride (CAS 1099660-64-6) is a chemical compound with the molecular formula C9H6ClNO2S2 and a molecular weight of 259.7 g/mol. IUPAC name: 4-(1,3-thiazol-2-yl)benzenesulfonyl chloride. InChIKey: IRQNEXIHOIGLOJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S2 |
|---|---|
| Molecular weight | 259.7 g/mol |
| IUPAC name | 4-(1,3-thiazol-2-yl)benzenesulfonyl chloride |
| InChIKey | IRQNEXIHOIGLOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CS2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)