CAS 1820712-07-9 is the registry number for 3-Phenyl-1,2-thiazole-4-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-phenyl-1,2-thiazole-4-sulfonyl chloride (CAS 1820712-07-9) is a chemical compound with the molecular formula C9H6ClNO2S2 and a molecular weight of 259.7 g/mol. IUPAC name: 3-phenyl-1,2-thiazole-4-sulfonyl chloride. InChIKey: GRJJOXYMJFRZFS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S2 |
|---|---|
| Molecular weight | 259.7 g/mol |
| IUPAC name | 3-phenyl-1,2-thiazole-4-sulfonyl chloride |
| InChIKey | GRJJOXYMJFRZFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)