CAS 151858-64-9 appears in our catalog under these names: 5-(2-Pyridyl)thiophene-2-sulfonyl chloride, 95%, 5-(Pyridin-2-yl)thiophene-2-sulfonyl chloride, 95+%, 5-(2-Pyridyl)thiophene-2-sulfonyl chloride, 5-(2-Pyridyl)thiophene-2-sulfonyl chloride, 95% , 5-Pyrid-2-ylthiophene-2-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 2,5g, 5g.
5-pyridin-2-ylthiophene-2-sulfonyl chloride (CAS 151858-64-9) is a chemical compound with the molecular formula C9H6ClNO2S2 and a molecular weight of 259.7 g/mol. IUPAC name: 5-pyridin-2-ylthiophene-2-sulfonyl chloride. InChIKey: OGOMWPWAEIDEOU-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S2 |
|---|---|
| Molecular weight | 259.7 g/mol |
| IUPAC name | 5-pyridin-2-ylthiophene-2-sulfonyl chloride |
| InChIKey | OGOMWPWAEIDEOU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(S2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)