CAS 1305712-05-3 appears in our catalog under these names: 2-Phenyl-1,3-thiazole-4-sulfonyl Chloride, 2-Phenylthiazole-4-sulfonyl chloride, 97%, 97%. Offered by: TRC, Chemat. Available pack sizes: 2,5g, 100mg, 250mg.
2-phenyl-1,3-thiazole-4-sulfonyl chloride (CAS 1305712-05-3) is a chemical compound with the molecular formula C9H6ClNO2S2 and a molecular weight of 259.7 g/mol. IUPAC name: 2-phenyl-1,3-thiazole-4-sulfonyl chloride. InChIKey: VZEAPYOMDBBPGZ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S2 |
|---|---|
| Molecular weight | 259.7 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazole-4-sulfonyl chloride |
| InChIKey | VZEAPYOMDBBPGZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)