Products 1099687-80-5
CAS 1099687-80-5 is the registry number for (1S,2S)-Threo-honokitriol. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
(1S,2S)-1-[4-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)phenyl]propane-1,2,3-triol (CAS 1099687-80-5) is a chemical compound with the molecular formula C18H20O5 and a molecular weight of 316.3 g/mol. IUPAC name: (1S,2S)-1-[4-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)phenyl]propane-1,2,3-triol. InChIKey: LKYOLPWSGNGKSH-ROUUACIJSA-N.
| Molecular formula | C18H20O5 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | (1S,2S)-1-[4-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)phenyl]propane-1,2,3-triol |
| InChIKey | LKYOLPWSGNGKSH-ROUUACIJSA-N |
| SMILES | C=CCC1=C(C=CC(=C1)C2=C(C=CC(=C2)[C@@H]([C@H](CO)O)O)O)O |
Computed by PubChem (NCBI)