Products 1100052-58-1
CAS 1100052-58-1 is the registry number for tert-Butyl 4-(4-bromophenyl)pyrazole-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Tert-butyl 4-(4-bromophenyl)pyrazole-1-carboxylate (CAS 1100052-58-1) is a chemical compound with the molecular formula C14H15BrN2O2 and a molecular weight of 323.18 g/mol. IUPAC name: tert-butyl 4-(4-bromophenyl)pyrazole-1-carboxylate. InChIKey: JWSVRTUIYMLKCO-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O2 |
|---|---|
| Molecular weight | 323.18 g/mol |
| IUPAC name | tert-butyl 4-(4-bromophenyl)pyrazole-1-carboxylate |
| InChIKey | JWSVRTUIYMLKCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)